C22H29NO5 — CID 10452806
1-O-tert-butyl 2-O-ethyl (2S,4Z)-5-oxo-4-(4-phenylbutylidene)pyrrolidine-1,2-dicarboxylate (PubChem CID 10452806) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2S,4Z)-5-oxo-4-(4-phenylbutylidene)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2S,4Z)-5-oxo-4-(4-phenylbutylidene)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10452806 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2S,4Z)-5-oxo-4-(4-phenylbutylidene)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C/C(=C/CCCc2ccccc2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H29NO5/c1-5-27-20(25)18-15-17(14-10-9-13-16-11-7-6-8-12-16)19(24)23(18)21(26)28-22(2,3)4/h6-8,11-12,14,18H,5,9-10,13,15H2,1-4H3/b17-14-/t18-/m0/s1 |
| InChIKey | JGOFPZFWJFRZQF-DNKLCNGGSA-N |
| XLogP | 4.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|