C16H24ClF2NO4 — CID 178027274
1-O-tert-butyl 2-O-ethyl 2-(3-chloropropyl)-3-(difluoromethylidene)pyrrolidine-1,2-dicarboxylate (PubChem CID 178027274) has the molecular formula C16H24ClF2NO4 and a molecular weight of 367.82 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 2-(3-chloropropyl)-3-(difluoromethylidene)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 2-(3-chloropropyl)-3-(difluoromethylidene)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 178027274 |
| Molecular Formula | C16H24ClF2NO4 |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 2-(3-chloropropyl)-3-(difluoromethylidene)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1(CCCCl)C(=C(F)F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24ClF2NO4/c1-5-23-13(21)16(8-6-9-17)11(12(18)19)7-10-20(16)14(22)24-15(2,3)4/h5-10H2,1-4H3 |
| InChIKey | LNOAVPQSYPEXFN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|