C14H25NO2 — CID 170117943
tert-butyl (3Z)-2,2-dimethyl-3-propylidenepyrrolidine-1-carboxylate (PubChem CID 170117943) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is tert-butyl (3Z)-2,2-dimethyl-3-propylidenepyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3Z)-2,2-dimethyl-3-propylidenepyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170117943 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | tert-butyl (3Z)-2,2-dimethyl-3-propylidenepyrrolidine-1-carboxylate |
| SMILES | CC/C=C1/CCN(C(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C14H25NO2/c1-7-8-11-9-10-15(14(11,5)6)12(16)17-13(2,3)4/h8H,7,9-10H2,1-6H3/b11-8- |
| InChIKey | NZDSQODCLYGQIH-FLIBITNWSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|