C14H24ClNO6 — CID 170357054
1-O-tert-butyl 2-O-methyl 2-(3-chloropropyl)-3,4-dihydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 170357054) has the molecular formula C14H24ClNO6 and a molecular weight of 337.80 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 2-(3-chloropropyl)-3,4-dihydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 2-(3-chloropropyl)-3,4-dihydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170357054 |
| Molecular Formula | C14H24ClNO6 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 2-(3-chloropropyl)-3,4-dihydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1(CCCCl)C(O)C(O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24ClNO6/c1-13(2,3)22-12(20)16-8-9(17)10(18)14(16,6-5-7-15)11(19)21-4/h9-10,17-18H,5-8H2,1-4H3 |
| InChIKey | HXCJEFDYLCQZLP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|