C16H25NO6 — CID 11727161
ditert-butyl (2S,4R)-4-formyl-6-oxopiperidine-1,2-dicarboxylate (PubChem CID 11727161) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is ditert-butyl (2S,4R)-4-formyl-6-oxopiperidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4R)-4-formyl-6-oxopiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11727161 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | ditert-butyl (2S,4R)-4-formyl-6-oxopiperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](C=O)CC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO6/c1-15(2,3)22-13(20)11-7-10(9-18)8-12(19)17(11)14(21)23-16(4,5)6/h9-11H,7-8H2,1-6H3/t10-,11+/m1/s1 |
| InChIKey | BDQMTRMLALKOPM-MNOVXSKESA-N |
| XLogP | 2.07 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|