C20H27NO6S — CID 25208042
tert-butyl (2S,4Z)-4-(2-ethoxy-2-oxoethylidene)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 25208042) has the molecular formula C20H27NO6S and a molecular weight of 409.50 g/mol. Its IUPAC name is tert-butyl (2S,4Z)-4-(2-ethoxy-2-oxoethylidene)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S,4Z)-4-(2-ethoxy-2-oxoethylidene)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 25208042 |
| Molecular Formula | C20H27NO6S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | tert-butyl (2S,4Z)-4-(2-ethoxy-2-oxoethylidene)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)/C=C1/C[C@@H](C(=O)OC(C)(C)C)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H27NO6S/c1-6-26-18(22)12-15-11-17(19(23)27-20(3,4)5)21(13-15)28(24,25)16-9-7-14(2)8-10-16/h7-10,12,17H,6,11,13H2,1-5H3/b15-12-/t17-/m0/s1 |
| InChIKey | MEYCFCKCWSVARZ-KSVUCXBSSA-N |
| XLogP | 2.59 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|