C20H20BrNO4S — CID 101269457
ethyl (2E)-2-[4-(4-bromophenyl)-1-(4-methylphenyl)sulfonylazetidin-2-ylidene]acetate (PubChem CID 101269457) has the molecular formula C20H20BrNO4S and a molecular weight of 450.35 g/mol. Its IUPAC name is ethyl (2E)-2-[4-(4-bromophenyl)-1-(4-methylphenyl)sulfonylazetidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[4-(4-bromophenyl)-1-(4-methylphenyl)sulfonylazetidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 101269457 |
| Molecular Formula | C20H20BrNO4S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | ethyl (2E)-2-[4-(4-bromophenyl)-1-(4-methylphenyl)sulfonylazetidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CC(c2ccc(Br)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H20BrNO4S/c1-3-26-20(23)13-17-12-19(15-6-8-16(21)9-7-15)22(17)27(24,25)18-10-4-14(2)5-11-18/h4-11,13,19H,3,12H2,1-2H3/b17-13+ |
| InChIKey | XFUWJWFGVHNIJJ-GHRIWEEISA-N |
| XLogP | 4.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|