C21H20F3NO5S — CID 135065389
ethyl (2E)-2-[(4R)-1-(4-methoxyphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]acetate (PubChem CID 135065389) has the molecular formula C21H20F3NO5S and a molecular weight of 455.45 g/mol. Its IUPAC name is ethyl (2E)-2-[(4R)-1-(4-methoxyphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(4R)-1-(4-methoxyphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 135065389 |
| Molecular Formula | C21H20F3NO5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | ethyl (2E)-2-[(4R)-1-(4-methoxyphenyl)sulfonyl-4-[4-(trifluoromethyl)phenyl]azetidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C[C@H](c2ccc(C(F)(F)F)cc2)N1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H20F3NO5S/c1-3-30-20(26)13-16-12-19(14-4-6-15(7-5-14)21(22,23)24)25(16)31(27,28)18-10-8-17(29-2)9-11-18/h4-11,13,19H,3,12H2,1-2H3/b16-13+/t19-/m1/s1 |
| InChIKey | YLCGMVLCJWFVQW-NRMGUKERSA-N |
| XLogP | 4.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|