C20H21F3N2O4S — CID 16829927
N-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 16829927) has the molecular formula C20H21F3N2O4S and a molecular weight of 442.46 g/mol. Its IUPAC name is N-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 16829927 |
| Molecular Formula | C20H21F3N2O4S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2CNC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H21F3N2O4S/c1-29-17-8-10-18(11-9-17)30(27,28)25-12-2-3-16(25)13-24-19(26)14-4-6-15(7-5-14)20(21,22)23/h4-11,16H,2-3,12-13H2,1H3,(H,24,26) |
| InChIKey | HTYJXNREZJAEOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |