C20H32N4O5S — CID 16812794
N-[2-(diethylamino)ethyl]-N'-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide (PubChem CID 16812794) has the molecular formula C20H32N4O5S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 16812794 |
| Molecular Formula | C20H32N4O5S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-[[1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]oxamide |
| SMILES | CCN(CC)CCNC(=O)C(=O)NCC1CCCN1S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H32N4O5S/c1-4-23(5-2)14-12-21-19(25)20(26)22-15-16-7-6-13-24(16)30(27,28)18-10-8-17(29-3)9-11-18/h8-11,16H,4-7,12-15H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | RXHBCJWRFUAHPE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|