C18H28N4O6S — CID 16808147
N-[2-(dimethylamino)ethyl]-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide (PubChem CID 16808147) has the molecular formula C18H28N4O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 16808147 |
| Molecular Formula | C18H28N4O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[[3-(4-methoxyphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCOC2CNC(=O)C(=O)NCCN(C)C)cc1 |
| InChI | InChI=1S/C18H28N4O6S/c1-21(2)11-9-19-17(23)18(24)20-13-16-22(10-4-12-28-16)29(25,26)15-7-5-14(27-3)6-8-15/h5-8,16H,4,9-13H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | UHPGRNFJJHUJCB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|