C15H24N4O5S2 — CID 40785400
N-[2-(dimethylamino)ethyl]-N'-[[(2S)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide (PubChem CID 40785400) has the molecular formula C15H24N4O5S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[[(2S)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[[(2S)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 40785400 |
| Molecular Formula | C15H24N4O5S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[[(2S)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NC[C@@H]1OCCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H24N4O5S2/c1-18(2)8-6-16-14(20)15(21)17-11-12-19(7-4-9-24-12)26(22,23)13-5-3-10-25-13/h3,5,10,12H,4,6-9,11H2,1-2H3,(H,16,20)(H,17,21)/t12-/m0/s1 |
| InChIKey | LKOCNWRRGGMCPX-LBPRGKRZSA-N |
| XLogP | -0.72 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|