C19H23N3O6S2 — CID 18561481
N-[2-(2-methoxyphenyl)ethyl]-N'-[(3-thiophen-2-ylsulfonyl-1,3-oxazolidin-2-yl)methyl]oxamide (PubChem CID 18561481) has the molecular formula C19H23N3O6S2 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-N'-[(3-thiophen-2-ylsulfonyl-1,3-oxazolidin-2-yl)methyl]oxamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-N'-[(3-thiophen-2-ylsulfonyl-1,3-oxazolidin-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 18561481 |
| Molecular Formula | C19H23N3O6S2 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-N'-[(3-thiophen-2-ylsulfonyl-1,3-oxazolidin-2-yl)methyl]oxamide |
| SMILES | COc1ccccc1CCNC(=O)C(=O)NCC1OCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H23N3O6S2/c1-27-15-6-3-2-5-14(15)8-9-20-18(23)19(24)21-13-16-22(10-11-28-16)30(25,26)17-7-4-12-29-17/h2-7,12,16H,8-11,13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | AHTSJIRQIYPHLE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|