C17H26N4O6S2 — CID 30469611
N-(2-morpholin-4-ylethyl)-N'-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide (PubChem CID 30469611) has the molecular formula C17H26N4O6S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-N'-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-N'-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 30469611 |
| Molecular Formula | C17H26N4O6S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-N'-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
| SMILES | O=C(NCCN1CCOCC1)C(=O)NC[C@H]1OCCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H26N4O6S2/c22-16(18-4-6-20-7-10-26-11-8-20)17(23)19-13-14-21(5-2-9-27-14)29(24,25)15-3-1-12-28-15/h1,3,12,14H,2,4-11,13H2,(H,18,22)(H,19,23)/t14-/m1/s1 |
| InChIKey | HREVBCMVBHRMEL-CQSZACIVSA-N |
| XLogP | -0.95 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|