C19H26F2N4O6S — CID 30469604
N'-[[(2S)-3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 30469604) has the molecular formula C19H26F2N4O6S and a molecular weight of 476.50 g/mol. Its IUPAC name is N'-[[(2S)-3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[[(2S)-3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 30469604 |
| Molecular Formula | C19H26F2N4O6S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N'-[[(2S)-3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | O=C(NCCN1CCOCC1)C(=O)NC[C@@H]1OCCCN1S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H26F2N4O6S/c20-14-2-3-15(21)16(12-14)32(28,29)25-5-1-9-31-17(25)13-23-19(27)18(26)22-4-6-24-7-10-30-11-8-24/h2-3,12,17H,1,4-11,13H2,(H,22,26)(H,23,27)/t17-/m0/s1 |
| InChIKey | KYMSCZAMQMTYIF-KRWDZBQOSA-N |
| XLogP | -0.73 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|