C19H27FN4O6S — CID 30469598
N'-[[(2S)-3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 30469598) has the molecular formula C19H27FN4O6S and a molecular weight of 458.51 g/mol. Its IUPAC name is N'-[[(2S)-3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[[(2S)-3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 30469598 |
| Molecular Formula | C19H27FN4O6S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N'-[[(2S)-3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | O=C(NCCN1CCOCC1)C(=O)NC[C@@H]1OCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H27FN4O6S/c20-15-2-4-16(5-3-15)31(27,28)24-7-1-11-30-17(24)14-22-19(26)18(25)21-6-8-23-9-12-29-13-10-23/h2-5,17H,1,6-14H2,(H,21,25)(H,22,26)/t17-/m0/s1 |
| InChIKey | QGSLWVKEZBKMRP-KRWDZBQOSA-N |
| XLogP | -0.87 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|