C17H20N4O5S2 — CID 41092845
N'-(pyridin-2-ylmethyl)-N-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide (PubChem CID 41092845) has the molecular formula C17H20N4O5S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N'-(pyridin-2-ylmethyl)-N-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide.
| Compound Name | N'-(pyridin-2-ylmethyl)-N-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 41092845 |
| Molecular Formula | C17H20N4O5S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N'-(pyridin-2-ylmethyl)-N-[[(2R)-3-thiophen-2-ylsulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
| SMILES | O=C(NCc1ccccn1)C(=O)NC[C@H]1OCCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H20N4O5S2/c22-16(19-11-13-5-1-2-7-18-13)17(23)20-12-14-21(8-4-9-26-14)28(24,25)15-6-3-10-27-15/h1-3,5-7,10,14H,4,8-9,11-12H2,(H,19,22)(H,20,23)/t14-/m1/s1 |
| InChIKey | NOSDNFDUXNGDCN-CQSZACIVSA-N |
| XLogP | 0.31 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|