C20H23FN4O5S — CID 18562595
N-[[3-(4-fluoro-3-methylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-2-ylmethyl)oxamide (PubChem CID 18562595) has the molecular formula C20H23FN4O5S and a molecular weight of 450.49 g/mol. Its IUPAC name is N-[[3-(4-fluoro-3-methylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N-[[3-(4-fluoro-3-methylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 18562595 |
| Molecular Formula | C20H23FN4O5S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[[3-(4-fluoro-3-methylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-(pyridin-2-ylmethyl)oxamide |
| SMILES | Cc1cc(S(=O)(=O)N2CCCOC2CNC(=O)C(=O)NCc2ccccn2)ccc1F |
| InChI | InChI=1S/C20H23FN4O5S/c1-14-11-16(6-7-17(14)21)31(28,29)25-9-4-10-30-18(25)13-24-20(27)19(26)23-12-15-5-2-3-8-22-15/h2-3,5-8,11,18H,4,9-10,12-13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | JECVHQJHWJYSJF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|