C16H23FN4O5S — CID 16807591
N-[2-(dimethylamino)ethyl]-N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide (PubChem CID 16807591) has the molecular formula C16H23FN4O5S and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 16807591 |
| Molecular Formula | C16H23FN4O5S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazolidin-2-yl]methyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NCC1OCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H23FN4O5S/c1-20(2)8-7-18-15(22)16(23)19-11-14-21(9-10-26-14)27(24,25)13-5-3-12(17)4-6-13/h3-6,14H,7-11H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | CLIKBYIGIJICAN-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|