C15H19F3N2O4S — CID 167743860
2-methoxy-N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 167743860) has the molecular formula C15H19F3N2O4S and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-methoxy-N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | 2-methoxy-N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 167743860 |
| Molecular Formula | C15H19F3N2O4S |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-methoxy-N-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(C(F)(F)F)ccc1C(=O)NC[C@H]1CCCN1S(C)(=O)=O |
| InChI | InChI=1S/C15H19F3N2O4S/c1-24-13-8-10(15(16,17)18)5-6-12(13)14(21)19-9-11-4-3-7-20(11)25(2,22)23/h5-6,8,11H,3-4,7,9H2,1-2H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | RQUOLHLTDBUTTP-LLVKDONJSA-N |
| XLogP | 1.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |