C13H16F3NO3 — CID 66681124
N-(1-hydroxy-2-methylpropan-2-yl)-2-methoxy-4-(trifluoromethyl)benzamide (PubChem CID 66681124) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-2-methoxy-4-(trifluoromethyl)benzamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-methoxy-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 66681124 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-methoxy-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(C(F)(F)F)ccc1C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C13H16F3NO3/c1-12(2,7-18)17-11(19)9-5-4-8(13(14,15)16)6-10(9)20-3/h4-6,18H,7H2,1-3H3,(H,17,19) |
| InChIKey | PPKOPDRMLVUHMM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |