C30H25F3N2O4S — CID 166558441
ethyl (2E)-2-[3-(4-methylphenyl)sulfonyl-1-[4-(trifluoromethyl)phenyl]-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate (PubChem CID 166558441) has the molecular formula C30H25F3N2O4S and a molecular weight of 566.60 g/mol. Its IUPAC name is ethyl (2E)-2-[3-(4-methylphenyl)sulfonyl-1-[4-(trifluoromethyl)phenyl]-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[3-(4-methylphenyl)sulfonyl-1-[4-(trifluoromethyl)phenyl]-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate |
|---|---|
| PubChem CID | 166558441 |
| Molecular Formula | C30H25F3N2O4S |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | ethyl (2E)-2-[3-(4-methylphenyl)sulfonyl-1-[4-(trifluoromethyl)phenyl]-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C2C=Cc3ccccc3N2C(c2ccc(C(F)(F)F)cc2)=CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H25F3N2O4S/c1-3-39-29(36)18-27-26-17-12-21-6-4-5-7-25(21)35(26)28(22-10-13-23(14-11-22)30(31,32)33)19-34(27)40(37,38)24-15-8-20(2)9-16-24/h4-19,26H,3H2,1-2H3/b27-18+ |
| InChIKey | NLONIPCAFOBNDK-OVVQPSECSA-N |
| XLogP | 6.37 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|