C30H28N2O4S — CID 166558451
ethyl (2E)-2-[9-methyl-3-(4-methylphenyl)sulfonyl-1-phenyl-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate (PubChem CID 166558451) has the molecular formula C30H28N2O4S and a molecular weight of 512.63 g/mol. Its IUPAC name is ethyl (2E)-2-[9-methyl-3-(4-methylphenyl)sulfonyl-1-phenyl-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[9-methyl-3-(4-methylphenyl)sulfonyl-1-phenyl-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate |
|---|---|
| PubChem CID | 166558451 |
| Molecular Formula | C30H28N2O4S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | ethyl (2E)-2-[9-methyl-3-(4-methylphenyl)sulfonyl-1-phenyl-4aH-pyrazino[1,2-a]quinolin-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C2C=Cc3ccc(C)cc3N2C(c2ccccc2)=CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H28N2O4S/c1-4-36-30(33)19-28-26-17-14-24-13-10-22(3)18-27(24)32(26)29(23-8-6-5-7-9-23)20-31(28)37(34,35)25-15-11-21(2)12-16-25/h5-20,26H,4H2,1-3H3/b28-19+ |
| InChIKey | HLJMBMNKFVXZRU-TURZUDJPSA-N |
| XLogP | 5.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|