C20H21NO2 — CID 102220944
ethyl (2R)-6-methyl-2-(4-methylphenyl)-2H-quinoline-1-carboxylate (PubChem CID 102220944) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is ethyl (2R)-6-methyl-2-(4-methylphenyl)-2H-quinoline-1-carboxylate.
| Compound Name | ethyl (2R)-6-methyl-2-(4-methylphenyl)-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 102220944 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | ethyl (2R)-6-methyl-2-(4-methylphenyl)-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(C)cc2C=C[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO2/c1-4-23-20(22)21-18(16-8-5-14(2)6-9-16)12-10-17-13-15(3)7-11-19(17)21/h5-13,18H,4H2,1-3H3/t18-/m1/s1 |
| InChIKey | UFSGXOLGYOZVOL-GOSISDBHSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |