C14H17NO3 — CID 141096762
2-methylpropyl 2-hydroxy-2H-quinoline-1-carboxylate (PubChem CID 141096762) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-methylpropyl 2-hydroxy-2H-quinoline-1-carboxylate.
| Compound Name | 2-methylpropyl 2-hydroxy-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 141096762 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-methylpropyl 2-hydroxy-2H-quinoline-1-carboxylate |
| SMILES | CC(C)COC(=O)N1c2ccccc2C=CC1O |
| InChI | InChI=1S/C14H17NO3/c1-10(2)9-18-14(17)15-12-6-4-3-5-11(12)7-8-13(15)16/h3-8,10,13,16H,9H2,1-2H3 |
| InChIKey | NSEOVBFVQOKGFS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |