C16H21NO4Si — CID 11493461
2-(1-methoxycarbonyl-2H-quinolin-2-yl)-2-trimethylsilylacetic acid (PubChem CID 11493461) has the molecular formula C16H21NO4Si and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(1-methoxycarbonyl-2H-quinolin-2-yl)-2-trimethylsilylacetic acid.
| Compound Name | 2-(1-methoxycarbonyl-2H-quinolin-2-yl)-2-trimethylsilylacetic acid |
|---|---|
| PubChem CID | 11493461 |
| Molecular Formula | C16H21NO4Si |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-(1-methoxycarbonyl-2H-quinolin-2-yl)-2-trimethylsilylacetic acid |
| SMILES | COC(=O)N1c2ccccc2C=CC1C(C(=O)O)[Si](C)(C)C |
| InChI | InChI=1S/C16H21NO4Si/c1-21-16(20)17-12-8-6-5-7-11(12)9-10-13(17)14(15(18)19)22(2,3)4/h5-10,13-14H,1-4H3,(H,18,19) |
| InChIKey | LHUGCDHFRKSYIT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|