C15H19NO2 — CID 102208485
methyl (2S)-2-butyl-2H-quinoline-1-carboxylate (PubChem CID 102208485) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl (2S)-2-butyl-2H-quinoline-1-carboxylate.
| Compound Name | methyl (2S)-2-butyl-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 102208485 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | methyl (2S)-2-butyl-2H-quinoline-1-carboxylate |
| SMILES | CCCC[C@H]1C=Cc2ccccc2N1C(=O)OC |
| InChI | InChI=1S/C15H19NO2/c1-3-4-8-13-11-10-12-7-5-6-9-14(12)16(13)15(17)18-2/h5-7,9-11,13H,3-4,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | UKMCOXYCXINLMS-ZDUSSCGKSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |