C18H21NO5 — CID 101357710
ethyl 2-(1-ethoxy-1,3-dioxobutan-2-yl)-2H-quinoline-1-carboxylate (PubChem CID 101357710) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 2-(1-ethoxy-1,3-dioxobutan-2-yl)-2H-quinoline-1-carboxylate.
| Compound Name | ethyl 2-(1-ethoxy-1,3-dioxobutan-2-yl)-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 101357710 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 2-(1-ethoxy-1,3-dioxobutan-2-yl)-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)C(C(C)=O)C1C=Cc2ccccc2N1C(=O)OCC |
| InChI | InChI=1S/C18H21NO5/c1-4-23-17(21)16(12(3)20)15-11-10-13-8-6-7-9-14(13)19(15)18(22)24-5-2/h6-11,15-16H,4-5H2,1-3H3 |
| InChIKey | QMKWXDRPOKCALJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|