C15H15NO2 — CID 11264981
ethyl 2-prop-2-ynyl-2H-quinoline-1-carboxylate (PubChem CID 11264981) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is ethyl 2-prop-2-ynyl-2H-quinoline-1-carboxylate.
| Compound Name | ethyl 2-prop-2-ynyl-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 11264981 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethyl 2-prop-2-ynyl-2H-quinoline-1-carboxylate |
| SMILES | C#CCC1C=Cc2ccccc2N1C(=O)OCC |
| InChI | InChI=1S/C15H15NO2/c1-3-7-13-11-10-12-8-5-6-9-14(12)16(13)15(17)18-4-2/h1,5-6,8-11,13H,4,7H2,2H3 |
| InChIKey | CYXBBRXDUBYOKG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|