C16H17NO4 — CID 11687850
(E)-4-(1-methoxycarbonyl-2H-quinolin-2-yl)-3-methylbut-2-enoic acid (PubChem CID 11687850) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is (E)-4-(1-methoxycarbonyl-2H-quinolin-2-yl)-3-methylbut-2-enoic acid.
| Compound Name | (E)-4-(1-methoxycarbonyl-2H-quinolin-2-yl)-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 11687850 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (E)-4-(1-methoxycarbonyl-2H-quinolin-2-yl)-3-methylbut-2-enoic acid |
| SMILES | COC(=O)N1c2ccccc2C=CC1C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C16H17NO4/c1-11(10-15(18)19)9-13-8-7-12-5-3-4-6-14(12)17(13)16(20)21-2/h3-8,10,13H,9H2,1-2H3,(H,18,19)/b11-10+ |
| InChIKey | JAFOSNDAVZVXHU-ZHACJKMWSA-N |
| XLogP | 3.08 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|