C18H22N2O6 — CID 135019935
dimethyl (3R,3aS,9aR)-3-butyl-2-oxo-3a,9a-dihydro-3H-furo[3,2-b]quinoxaline-4,9-dicarboxylate (PubChem CID 135019935) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is dimethyl (3R,3aS,9aR)-3-butyl-2-oxo-3a,9a-dihydro-3H-furo[3,2-b]quinoxaline-4,9-dicarboxylate.
| Compound Name | dimethyl (3R,3aS,9aR)-3-butyl-2-oxo-3a,9a-dihydro-3H-furo[3,2-b]quinoxaline-4,9-dicarboxylate |
|---|---|
| PubChem CID | 135019935 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | dimethyl (3R,3aS,9aR)-3-butyl-2-oxo-3a,9a-dihydro-3H-furo[3,2-b]quinoxaline-4,9-dicarboxylate |
| SMILES | CCCC[C@H]1C(=O)O[C@@H]2[C@H]1N(C(=O)OC)c1ccccc1N2C(=O)OC |
| InChI | InChI=1S/C18H22N2O6/c1-4-5-8-11-14-15(26-16(11)21)20(18(23)25-3)13-10-7-6-9-12(13)19(14)17(22)24-2/h6-7,9-11,14-15H,4-5,8H2,1-3H3/t11-,14+,15-/m1/s1 |
| InChIKey | WFQLTHCIJFLGSI-BYCMXARLSA-N |
| XLogP | 2.90 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|