C16H18INO4 — CID 135019850
methyl (1R,9R,13R)-13-iodo-11-oxo-10-propyl-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxylate (PubChem CID 135019850) has the molecular formula C16H18INO4 and a molecular weight of 415.23 g/mol. Its IUPAC name is methyl (1R,9R,13R)-13-iodo-11-oxo-10-propyl-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxylate.
| Compound Name | methyl (1R,9R,13R)-13-iodo-11-oxo-10-propyl-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxylate |
|---|---|
| PubChem CID | 135019850 |
| Molecular Formula | C16H18INO4 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | methyl (1R,9R,13R)-13-iodo-11-oxo-10-propyl-12-oxa-8-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-8-carboxylate |
| SMILES | CCCC1C(=O)O[C@@H]2c3ccccc3N(C(=O)OC)[C@H]1[C@H]2I |
| InChI | InChI=1S/C16H18INO4/c1-3-6-10-13-12(17)14(22-15(10)19)9-7-4-5-8-11(9)18(13)16(20)21-2/h4-5,7-8,10,12-14H,3,6H2,1-2H3/t10?,12-,13-,14-/m1/s1 |
| InChIKey | POCMGIRQOUZKGH-FYFXECOGSA-N |
| XLogP | 3.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|