C22H33NO3 — CID 174383459
tert-butyl 2-[2-methyl-1-(2-methylpropoxy)propyl]-2H-quinoline-1-carboxylate (PubChem CID 174383459) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is tert-butyl 2-[2-methyl-1-(2-methylpropoxy)propyl]-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 2-[2-methyl-1-(2-methylpropoxy)propyl]-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 174383459 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | tert-butyl 2-[2-methyl-1-(2-methylpropoxy)propyl]-2H-quinoline-1-carboxylate |
| SMILES | CC(C)COC(C(C)C)C1C=Cc2ccccc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33NO3/c1-15(2)14-25-20(16(3)4)19-13-12-17-10-8-9-11-18(17)23(19)21(24)26-22(5,6)7/h8-13,15-16,19-20H,14H2,1-7H3 |
| InChIKey | KECZLONTPKFVFE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |