C19H23NO4Si — CID 134954251
1-O-ethyl 6-O-methyl (2S)-2-(2-trimethylsilylethynyl)-2H-quinoline-1,6-dicarboxylate (PubChem CID 134954251) has the molecular formula C19H23NO4Si and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-O-ethyl 6-O-methyl (2S)-2-(2-trimethylsilylethynyl)-2H-quinoline-1,6-dicarboxylate.
| Compound Name | 1-O-ethyl 6-O-methyl (2S)-2-(2-trimethylsilylethynyl)-2H-quinoline-1,6-dicarboxylate |
|---|---|
| PubChem CID | 134954251 |
| Molecular Formula | C19H23NO4Si |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-O-ethyl 6-O-methyl (2S)-2-(2-trimethylsilylethynyl)-2H-quinoline-1,6-dicarboxylate |
| SMILES | CCOC(=O)N1c2ccc(C(=O)OC)cc2C=C[C@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H23NO4Si/c1-6-24-19(22)20-16(11-12-25(3,4)5)9-7-14-13-15(18(21)23-2)8-10-17(14)20/h7-10,13,16H,6H2,1-5H3/t16-/m0/s1 |
| InChIKey | NEZYXMIFVSIZIQ-INIZCTEOSA-N |
| XLogP | 3.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|