C27H25NO3S — CID 132538300
2-[(1S)-2-(4-methylphenyl)sulfonyl-3-phenyl-1H-isoquinolin-1-yl]pent-1-en-3-one (PubChem CID 132538300) has the molecular formula C27H25NO3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-[(1S)-2-(4-methylphenyl)sulfonyl-3-phenyl-1H-isoquinolin-1-yl]pent-1-en-3-one.
| Compound Name | 2-[(1S)-2-(4-methylphenyl)sulfonyl-3-phenyl-1H-isoquinolin-1-yl]pent-1-en-3-one |
|---|---|
| PubChem CID | 132538300 |
| Molecular Formula | C27H25NO3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[(1S)-2-(4-methylphenyl)sulfonyl-3-phenyl-1H-isoquinolin-1-yl]pent-1-en-3-one |
| SMILES | C=C(C(=O)CC)[C@@H]1c2ccccc2C=C(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H25NO3S/c1-4-26(29)20(3)27-24-13-9-8-12-22(24)18-25(21-10-6-5-7-11-21)28(27)32(30,31)23-16-14-19(2)15-17-23/h5-18,27H,3-4H2,1-2H3/t27-/m1/s1 |
| InChIKey | RIGMOUQHABVBPP-HHHXNRCGSA-N |
| XLogP | 5.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|