C29H29NO5S — CID 53230920
ethyl 2-[(2S,3R)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate (PubChem CID 53230920) has the molecular formula C29H29NO5S and a molecular weight of 503.62 g/mol. Its IUPAC name is ethyl 2-[(2S,3R)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(2S,3R)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53230920 |
| Molecular Formula | C29H29NO5S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | ethyl 2-[(2S,3R)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H]1[C@@H](c2ccc(OC)cc2)C=C(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H29NO5S/c1-5-35-29(31)21(3)28-26(22-13-15-24(34-4)16-14-22)19-27(23-9-7-6-8-10-23)30(28)36(32,33)25-17-11-20(2)12-18-25/h6-19,26,28H,3,5H2,1-2,4H3/t26-,28-/m1/s1 |
| InChIKey | NHKCFXCTRFPYEQ-IXCJQBJRSA-N |
| XLogP | 5.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|