C21H29BrN2O3S — CID 177360711
triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]azanium bromide (PubChem CID 177360711) has the molecular formula C21H29BrN2O3S and a molecular weight of 469.45 g/mol. Its IUPAC name is triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]azanium bromide.
| Compound Name | triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]azanium bromide |
|---|---|
| PubChem CID | 177360711 |
| Molecular Formula | C21H29BrN2O3S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]azanium bromide |
| SMILES | CC[N+](CC)(CC)C1c2ccccc2N(S(=O)(=O)c2ccc(C)cc2)C1O.[Br-] |
| InChI | InChI=1S/C21H29N2O3S.BrH/c1-5-23(6-2,7-3)20-18-10-8-9-11-19(18)22(21(20)24)27(25,26)17-14-12-16(4)13-15-17;/h8-15,20-21,24H,5-7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | JDHZKSXBGGNRCH-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|