C36H31N3O6S3 — CID 92905380
2-[4-[(1S,9S)-8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]phenyl]sulfanylacetic acid (PubChem CID 92905380) has the molecular formula C36H31N3O6S3 and a molecular weight of 697.86 g/mol. Its IUPAC name is 2-[4-[(1S,9S)-8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]phenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[(1S,9S)-8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 92905380 |
| Molecular Formula | C36H31N3O6S3 |
| Molecular Weight | 697.86 g/mol |
| Exact Mass | 697.14 |
| IUPAC Name | 2-[4-[(1S,9S)-8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]phenyl]sulfanylacetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3[C@H]3N(c4ccc(SCC(=O)O)cc4)[C@@H]2c2ccccc2N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H31N3O6S3/c1-24-11-19-28(20-12-24)47(42,43)38-32-9-5-3-7-30(32)36-37(26-15-17-27(18-16-26)46-23-34(40)41)35(38)31-8-4-6-10-33(31)39(36)48(44,45)29-21-13-25(2)14-22-29/h3-22,35-36H,23H2,1-2H3,(H,40,41)/t35-,36-/m0/s1 |
| InChIKey | LFYAXIZCYSPNER-ZPGRZCPFSA-N |
| XLogP | 7.10 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.86 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |