C8H9NO4S2 — CID 43453735
2-(4-sulfamoylphenyl)sulfanylacetic acid (PubChem CID 43453735) has the molecular formula C8H9NO4S2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-(4-sulfamoylphenyl)sulfanylacetic acid.
| Compound Name | 2-(4-sulfamoylphenyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 43453735 |
| Molecular Formula | C8H9NO4S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 2-(4-sulfamoylphenyl)sulfanylacetic acid |
| SMILES | NS(=O)(=O)c1ccc(SCC(=O)O)cc1 |
| InChI | InChI=1S/C8H9NO4S2/c9-15(12,13)7-3-1-6(2-4-7)14-5-8(10)11/h1-4H,5H2,(H,10,11)(H2,9,12,13) |
| InChIKey | WSYWEZGFWBZGEL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |