C17H19ClN2O3S2 — CID 55439516
2-(4-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 55439516) has the molecular formula C17H19ClN2O3S2 and a molecular weight of 398.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55439516 |
| Molecular Formula | C17H19ClN2O3S2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O3S2/c1-12(13-3-9-16(10-4-13)25(19,22)23)20(2)17(21)11-24-15-7-5-14(18)6-8-15/h3-10,12H,11H2,1-2H3,(H2,19,22,23) |
| InChIKey | RXVWAFPNBYGSSU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |