C16H14O4S4 — CID 54542120
2-[4-[[4-(carboxymethylsulfanyl)phenyl]disulfanyl]phenyl]sulfanylacetic acid (PubChem CID 54542120) has the molecular formula C16H14O4S4 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[4-[[4-(carboxymethylsulfanyl)phenyl]disulfanyl]phenyl]sulfanylacetic acid.
| Compound Name | 2-[4-[[4-(carboxymethylsulfanyl)phenyl]disulfanyl]phenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 54542120 |
| Molecular Formula | C16H14O4S4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 2-[4-[[4-(carboxymethylsulfanyl)phenyl]disulfanyl]phenyl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1ccc(SSc2ccc(SCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H14O4S4/c17-15(18)9-21-11-1-5-13(6-2-11)23-24-14-7-3-12(4-8-14)22-10-16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | ZDYOKBPSEVTJKE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|