C16H14O6S3 — CID 171774523
2-[5,7-bis(carboxymethylsulfanyl)naphthalen-2-yl]sulfanylacetic acid (PubChem CID 171774523) has the molecular formula C16H14O6S3 and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[5,7-bis(carboxymethylsulfanyl)naphthalen-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5,7-bis(carboxymethylsulfanyl)naphthalen-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 171774523 |
| Molecular Formula | C16H14O6S3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 2-[5,7-bis(carboxymethylsulfanyl)naphthalen-2-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1ccc2c(SCC(=O)O)cc(SCC(=O)O)cc2c1 |
| InChI | InChI=1S/C16H14O6S3/c17-14(18)6-23-10-1-2-12-9(3-10)4-11(24-7-15(19)20)5-13(12)25-8-16(21)22/h1-5H,6-8H2,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | XHXCENHLCNXCMV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |