C16H14Cl2O2S3 — CID 143165925
2-[4-chloro-2-(2-chloro-4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylacetic acid (PubChem CID 143165925) has the molecular formula C16H14Cl2O2S3 and a molecular weight of 405.39 g/mol. Its IUPAC name is 2-[4-chloro-2-(2-chloro-4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylacetic acid.
| Compound Name | 2-[4-chloro-2-(2-chloro-4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 143165925 |
| Molecular Formula | C16H14Cl2O2S3 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 2-[4-chloro-2-(2-chloro-4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylacetic acid |
| SMILES | CCSc1ccc(Sc2cc(Cl)ccc2SCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O2S3/c1-2-21-11-4-6-13(12(18)8-11)23-15-7-10(17)3-5-14(15)22-9-16(19)20/h3-8H,2,9H2,1H3,(H,19,20) |
| InChIKey | UAASHYNJASEANW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |