C12H13O5S2- — CID 19356368
2,4-bis[(2-methoxy-2-oxoethyl)sulfanyl]phenolate (PubChem CID 19356368) has the molecular formula C12H13O5S2- and a molecular weight of 301.37 g/mol. Its IUPAC name is 2,4-bis[(2-methoxy-2-oxoethyl)sulfanyl]phenolate.
| Compound Name | 2,4-bis[(2-methoxy-2-oxoethyl)sulfanyl]phenolate |
|---|---|
| PubChem CID | 19356368 |
| Molecular Formula | C12H13O5S2- |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2,4-bis[(2-methoxy-2-oxoethyl)sulfanyl]phenolate |
| SMILES | COC(=O)CSc1ccc([O-])c(SCC(=O)OC)c1 |
| InChI | InChI=1S/C12H14O5S2/c1-16-11(14)6-18-8-3-4-9(13)10(5-8)19-7-12(15)17-2/h3-5,13H,6-7H2,1-2H3/p-1 |
| InChIKey | SWNBHLGBHJHENI-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |