C8H7Cl2NO2S — CID 4053646
methyl 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetate (PubChem CID 4053646) has the molecular formula C8H7Cl2NO2S and a molecular weight of 252.12 g/mol. Its IUPAC name is methyl 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetate.
| Compound Name | methyl 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetate |
|---|---|
| PubChem CID | 4053646 |
| Molecular Formula | C8H7Cl2NO2S |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | methyl 2-[(2,6-dichloro-4-pyridinyl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NO2S/c1-13-8(12)4-14-5-2-6(9)11-7(10)3-5/h2-3H,4H2,1H3 |
| InChIKey | HVCSUZVFRPESBM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|