C10H10N2O6S — CID 3521492
methyl 2-(4-methyl-3,5-dinitrophenyl)sulfanylacetate (PubChem CID 3521492) has the molecular formula C10H10N2O6S and a molecular weight of 286.27 g/mol. Its IUPAC name is methyl 2-(4-methyl-3,5-dinitrophenyl)sulfanylacetate.
| Compound Name | methyl 2-(4-methyl-3,5-dinitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 3521492 |
| Molecular Formula | C10H10N2O6S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | methyl 2-(4-methyl-3,5-dinitrophenyl)sulfanylacetate |
| SMILES | COC(=O)CSc1cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N2O6S/c1-6-8(11(14)15)3-7(4-9(6)12(16)17)19-5-10(13)18-2/h3-4H,5H2,1-2H3 |
| InChIKey | ZQYNCFJWJOJDRQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|