C13H19NO2S — CID 63809966
methyl 2-[4-(ethylaminomethyl)-3-methylphenyl]sulfanylacetate (PubChem CID 63809966) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is methyl 2-[4-(ethylaminomethyl)-3-methylphenyl]sulfanylacetate.
| Compound Name | methyl 2-[4-(ethylaminomethyl)-3-methylphenyl]sulfanylacetate |
|---|---|
| PubChem CID | 63809966 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl 2-[4-(ethylaminomethyl)-3-methylphenyl]sulfanylacetate |
| SMILES | CCNCc1ccc(SCC(=O)OC)cc1C |
| InChI | InChI=1S/C13H19NO2S/c1-4-14-8-11-5-6-12(7-10(11)2)17-9-13(15)16-3/h5-7,14H,4,8-9H2,1-3H3 |
| InChIKey | WVVMCWSXGPKFBR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |