C13H16BrNO2S — CID 114061088
methyl 2-[3-bromo-4-[(cyclopropylamino)methyl]phenyl]sulfanylacetate (PubChem CID 114061088) has the molecular formula C13H16BrNO2S and a molecular weight of 330.25 g/mol. Its IUPAC name is methyl 2-[3-bromo-4-[(cyclopropylamino)methyl]phenyl]sulfanylacetate.
| Compound Name | methyl 2-[3-bromo-4-[(cyclopropylamino)methyl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 114061088 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | methyl 2-[3-bromo-4-[(cyclopropylamino)methyl]phenyl]sulfanylacetate |
| SMILES | COC(=O)CSc1ccc(CNC2CC2)c(Br)c1 |
| InChI | InChI=1S/C13H16BrNO2S/c1-17-13(16)8-18-11-5-2-9(12(14)6-11)7-15-10-3-4-10/h2,5-6,10,15H,3-4,7-8H2,1H3 |
| InChIKey | RCJBGFYECOUGCL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |