C13H16BrNOS — CID 114061111
N-[[2-bromo-4-(oxetan-3-ylsulfanyl)phenyl]methyl]cyclopropanamine (PubChem CID 114061111) has the molecular formula C13H16BrNOS and a molecular weight of 314.25 g/mol. Its IUPAC name is N-[[2-bromo-4-(oxetan-3-ylsulfanyl)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-bromo-4-(oxetan-3-ylsulfanyl)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114061111 |
| Molecular Formula | C13H16BrNOS |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | N-[[2-bromo-4-(oxetan-3-ylsulfanyl)phenyl]methyl]cyclopropanamine |
| SMILES | Brc1cc(SC2COC2)ccc1CNC1CC1 |
| InChI | InChI=1S/C13H16BrNOS/c14-13-5-11(17-12-7-16-8-12)4-1-9(13)6-15-10-2-3-10/h1,4-5,10,12,15H,2-3,6-8H2 |
| InChIKey | IUSZBTMEAHUPDQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |