C17H24BrNO2 — CID 103245649
3-bromo-4-[[(4-propylcyclohexyl)amino]methyl]benzoic acid (PubChem CID 103245649) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 3-bromo-4-[[(4-propylcyclohexyl)amino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[(4-propylcyclohexyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 103245649 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3-bromo-4-[[(4-propylcyclohexyl)amino]methyl]benzoic acid |
| SMILES | CCCC1CCC(NCc2ccc(C(=O)O)cc2Br)CC1 |
| InChI | InChI=1S/C17H24BrNO2/c1-2-3-12-4-8-15(9-5-12)19-11-14-7-6-13(17(20)21)10-16(14)18/h6-7,10,12,15,19H,2-5,8-9,11H2,1H3,(H,20,21) |
| InChIKey | WWZKBYGVIRWKDH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |